![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| syllabus420.htm | 2022-11-23 07:02 | 197K | |
| 420/ | 2022-11-23 07:00 | - | |
| 422/ | 2022-11-20 05:41 | - | |
| MeanAndSTD.xlsx | 2022-10-18 14:32 | 17K | |
| Introduction to Investment Theories.pptx | 2022-10-18 10:06 | 203K | |
| syllabus422.htm | 2022-10-17 07:06 | 208K | |
| syllabus422_files/ | 2022-10-17 07:06 | - | |
| Thumbs.db | 2022-10-11 17:36 | 6.0K | |
| rating migration.xlsx | 2022-10-05 06:47 | 31K | |
| ~$rating migration.xlsx | 2022-10-05 06:47 | 165 | |
| syllabus422Copy.htm | 2022-05-11 08:20 | 207K | |
| syllabus627_files/ | 2022-04-28 09:20 | - | |
| syllabus627.htm | 2022-04-28 09:14 | 67K | |
| Pension.pdf | 2022-01-10 09:19 | 94K | |
| ~$Introduction to Investment Theories.pptx | 2021-10-29 08:33 | 165 | |
| MM Theory A Societal Perspective.pdf | 2021-09-19 08:42 | 83K | |
| syllabus422N.htm | 2021-09-08 13:47 | 206K | |
| syllabus420N_files/ | 2021-08-30 11:23 | - | |
| syllabus420Video.htm | 2021-08-30 11:23 | 201K | |
| syllabus422N_files/ | 2021-08-30 11:21 | - | |
| syllabus422Video.htm | 2021-08-30 11:21 | 213K | |
| syllabus422Copy_files/ | 2021-01-07 20:35 | - | |
| syllabus420Copy_files/ | 2021-01-07 20:33 | - | |
| syllabus420Copy.htm | 2021-01-07 20:33 | 200K | |
| syllabus429_files/ | 2021-01-06 11:19 | - | |
| syllabus429.htm | 2021-01-06 11:18 | 78K | |
| old/ | 2020-10-17 08:23 | - | |
| ~$llabus420.htm | 2020-09-04 10:26 | 162 | |
| syllabus420_files/ | 2020-08-22 12:51 | - | |
| 323/ | 2020-03-09 12:40 | - | |
| syllabus323_files/ | 2020-01-06 13:51 | - | |
| syllabus323.htm | 2020-01-06 13:51 | 228K | |
| ExValue.doc | 2019-04-29 08:57 | 181K | |
| ExValue.xls | 2019-04-29 08:57 | 64K | |
| ~$xValue.doc | 2019-04-29 08:35 | 162 | |
| 725/ | 2019-01-09 14:44 | - | |
| syllabus725_files/ | 2019-01-09 14:44 | - | |
| syllabus725.htm | 2019-01-09 14:44 | 156K | |
| syllabus421.docx | 2018-12-13 11:09 | 16K | |
| BehavioralFinance.pdf | 2018-12-13 11:08 | 94K | |
| syllabus429.docx | 2018-12-13 11:07 | 16K | |
| Derivatives.pdf | 2018-12-13 10:59 | 146K | |
| 725New.docx | 2018-11-26 11:59 | 37K | |
| ExProduction.doc | 2018-11-06 08:02 | 47K | |
| syllabus423_files/ | 2018-10-31 19:12 | - | |
| syllabus423.htm | 2018-10-31 19:12 | 218K | |
| 421/ | 2018-04-10 10:39 | - | |
| ExInvestment.doc | 2018-03-15 14:21 | 69K | |
| syllabus421.htm | 2018-03-13 15:44 | 80K | |
| syllabus627Old.htm | 2018-01-11 18:49 | 48K | |
| ExCapital structure.xls | 2017-12-01 15:59 | 72K | |
| ExCapital structure.doc | 2017-11-29 10:30 | 29K | |
| ExProduction.xls | 2017-10-30 14:27 | 144K | |
| ExMonetaryPolicy.xls | 2017-10-27 12:19 | 95K | |
| ExMonetaryPolicy.doc | 2017-10-27 12:17 | 28K | |
| 423/ | 2017-10-18 09:33 | - | |
| ProjectGrading.docx | 2017-09-12 05:17 | 12K | |
| option.xls | 2017-01-25 07:58 | 37K | |
| syllabus421_files/ | 2017-01-03 15:27 | - | |
| ~$llabus422.htm | 2016-09-12 10:08 | 162 | |
| syllabus220.htm | 2014-11-20 15:45 | 45K | |
| 220/ | 2014-11-13 00:04 | - | |
| 620/ | 2014-09-29 14:20 | - | |
| Homework.xls | 2014-09-16 15:32 | 162K | |
| syllabus220_files/ | 2014-09-03 10:07 | - | |
| notes/ | 2014-03-26 18:04 | - | |
| Investment.xls | 2014-03-09 11:45 | 45K | |
| syllabus620.htm | 2014-01-13 16:28 | 43K | |
| syllabus620_files/ | 2013-12-11 16:02 | - | |
| ExInvestment.xls | 2013-10-27 19:39 | 126K | |
| ExJudgment.doc | 2013-10-15 09:33 | 25K | |
| 429/ | 2013-10-14 13:40 | - | |
| ExLearning.doc | 2013-10-07 16:43 | 30K | |
| ExInformation.doc | 2013-10-01 09:33 | 28K | |
| ExPsychology.xls | 2012-04-20 20:24 | 44K | |
| ExPsychology.doc | 2012-04-20 20:21 | 44K | |
| ExJudgment.xls | 2012-02-15 11:39 | 25K | |
| ~$llabus423.htm | 2011-10-13 13:48 | 162 | |
| HomeworkSustainability.doc | 2011-04-05 10:47 | 64K | |
| HomeworkLimitedLiability.doc | 2011-01-16 12:38 | 27K | |
| slides423/ | 2010-09-08 13:42 | - | |
| project/ | 2010-03-12 21:20 | - | |
| ExLearning.xls | 2010-01-18 16:34 | 24K | |
| ExMind.doc | 2010-01-12 07:56 | 28K | |
| ExInformation.xls | 2010-01-04 10:00 | 41K | |
| project.htm | 2008-06-20 12:56 | 15K | |
| ExPrice.doc | 2008-03-11 12:11 | 25K | |
| ExRiskValue.xls | 2007-12-03 15:25 | 51K | |
| ExRiskValue.doc | 2007-12-03 15:24 | 30K | |
| ExTransaction.xls | 2007-11-09 12:09 | 20K | |
| ExTransaction.doc | 2007-11-09 12:09 | 44K | |
| ExMind.xls | 2007-09-26 11:00 | 20K | |
| WhyStudyFinance.htm | 2006-10-17 11:15 | 5.7K | |
| M&A.xls | 2006-03-12 17:06 | 20K | |
| M&A.doc | 2006-03-12 17:06 | 81K | |
| ExDemography.xls | 2006-03-09 17:38 | 14K | |
| ExDemography.doc | 2006-03-09 17:38 | 26K | |
| ExCombine.xls | 2006-03-08 14:27 | 22K | |
| ExCombine.doc | 2006-03-08 14:27 | 46K | |
| ExEnt.doc | 2006-02-28 15:22 | 20K | |
| ExEnt.xls | 2006-02-28 15:22 | 17K | |
| ExPrice.xls | 2006-02-23 14:07 | 24K | |
| Chap2.xls | 2006-01-23 10:44 | 20K | |
| Chap3.xls | 2006-01-23 10:21 | 31K | |
| homework423.htm | 2005-09-02 13:27 | 3.3K | |
| applications of option theory.doc | 2002-10-30 09:42 | 36K | |