![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| homework/ | 2020-02-27 11:32 | - | |
| notes/ | 2022-11-27 07:03 | - | |
| slides/ | 2016-09-12 10:21 | - | |
| ~$esentationSchedule.doc | 2013-02-07 16:51 | 162 | |
| ~$Introduction.pptx | 2021-09-09 06:26 | 165 | |
| value.xlsx | 2021-11-04 12:09 | 11K | |
| Thumbs.db | 2022-11-16 06:37 | 15K | |
| Capital Structure.xlsx | 2017-10-09 14:17 | 16K | |
| CPP.xlsx | 2021-11-19 21:31 | 17K | |
| PresentationSchedule.docx | 2013-03-07 10:35 | 20K | |
| 3.doc | 2009-10-19 11:32 | 26K | |
| ExtraHomework.doc | 2007-11-27 14:42 | 26K | |
| Homework1.doc | 2010-01-06 13:22 | 26K | |
| midterm2010f.xls | 2010-10-14 14:57 | 26K | |
| Homework2.doc | 2010-01-06 13:37 | 27K | |
| midterm.doc | 2008-02-18 11:29 | 27K | |
| Hedge The best hedging.pdf | 2021-12-09 08:14 | 28K | |
| Homework4.doc | 2010-02-09 23:15 | 36K | |
| midterm2010w.doc | 2010-02-24 08:12 | 37K | |
| overviewBack.doc | 2011-09-03 21:18 | 37K | |
| 2.doc | 2009-09-21 13:07 | 38K | |
| reading.htm | 2009-11-16 13:02 | 40K | |
| ExtraHomework.xls | 2007-11-27 14:33 | 41K | |
| review.doc | 2011-12-02 11:40 | 42K | |
| review.xls | 2011-12-02 11:46 | 45K | |
| Homework3.doc | 2010-02-02 15:03 | 54K | |
| IntroductionN.pptx | 2021-09-07 07:15 | 81K | |
| Introduction.pptx | 2022-09-25 21:14 | 108K | |
| Theory of Value Applications.pptx | 2022-11-20 05:39 | 372K | |
| demographics.pdf | 2009-11-16 12:54 | 685K | |
| CPI.pdf | 2008-05-05 13:19 | 1.9M | |
| NextBubble.pdf | 2009-09-17 11:37 | 3.4M | |