![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Discounting, Asset Valuation and Monetary Policy.pptx | 2022-11-07 07:41 | 204K | |
| Discounting.pptx | 2020-09-06 17:29 | 232K | |
| Financing&LimitedLiability.ppt | 2017-10-03 10:55 | 166K | |
| Financing Options and Capital Structure.pptx | 2020-02-06 12:55 | 303K | |
| Financing Options and Capital Structure.xlsx | 2018-01-28 20:09 | 10K | |
| FixedCost.pptx | 2022-10-24 11:26 | 393K | |
| Insurance.pptx | 2022-10-20 13:16 | 174K | |
| Pension.pptx | 2022-10-20 13:12 | 212K | |
| Project.doc | 2014-02-11 16:55 | 24K | |
| RRR.doc | 2012-03-14 11:53 | 68K | |
| Review.pptx | 2018-04-03 15:55 | 35K | |
| RiskProfit.pptx | 2022-10-20 13:20 | 167K | |
| RiskProfitOld.ppt | 2020-09-27 10:29 | 215K | |
| StockIndex.xlsx | 2013-03-07 10:32 | 27K | |
| Thumbs.db | 2022-11-07 09:57 | 111K | |
| back/ | 2022-01-31 11:31 | - | |
| calculations.xls | 2020-09-07 11:25 | 40K | |
| insurance.xlsx | 2022-10-17 07:24 | 15K | |
| investment.ppt | 2011-09-19 11:23 | 108K | |
| notes.xls | 2020-09-07 10:49 | 206K | |
| notes.xlsx | 2022-11-07 07:43 | 80K | |
| overview.docx | 2018-01-04 14:21 | 26K | |
| sustainability.pptx | 2022-11-27 07:03 | 339K | |
| value.xls | 2013-10-24 08:48 | 24K | |
| ~$FixedCost.pptx | 2020-09-15 18:33 | 165 | |
| ~$Pension.pptx | 2021-11-17 08:30 | 165 | |
| ~$erview.docx | 2016-09-12 12:46 | 162 | |
| ~$roject.doc | 2013-02-07 16:42 | 162 | |